C24H43N3O2 — CID 177388340
2-[1-(2-aminoethyl)-2-[(E)-heptadec-8-enyl]imidazol-1-ium-1-yl]acetate (PubChem CID 177388340) has the molecular formula C24H43N3O2 and a molecular weight of 405.63 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)-2-[(E)-heptadec-8-enyl]imidazol-1-ium-1-yl]acetate.
| Compound Name | 2-[1-(2-aminoethyl)-2-[(E)-heptadec-8-enyl]imidazol-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 177388340 |
| Molecular Formula | C24H43N3O2 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 2-[1-(2-aminoethyl)-2-[(E)-heptadec-8-enyl]imidazol-1-ium-1-yl]acetate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=NC=C[N+]1(CCN)CC(=O)[O-] |
| InChI | InChI=1S/C24H43N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-26-19-21-27(23,20-18-25)22-24(28)29/h9-10,19,21H,2-8,11-18,20,22,25H2,1H3/b10-9+ |
| InChIKey | IMDIKTMVBOCXAZ-MDZDMXLPSA-N |
| XLogP | 4.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|