About 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine
1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine (PubChem CID 177388576) has the molecular formula C35H45N4+
and a molecular weight of 521.77 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine.
Molecular Properties
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine |
| PubChem CID | 177388576 |
| Molecular Formula | C35H45N4+ |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.36 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine |
| SMILES | C=CCNc1c(-c2ccccc2)n(-c2c(C(C)C)cccc2C(C)C)n[n+]1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C35H45N4/c1-10-22-36-35-32(27-16-12-11-13-17-27)38(33-28(23(2)3)18-14-19-29(33)24(4)5)37-39(35)34-30(25(6)7)20-15-21-31(34)26(8)9/h10-21,23-26,36H,1,22H2,2-9H3/q+1 |
| InChIKey | CCXBIEUZAMRUCG-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine?
The IUPAC name of 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine (CID 177388576) is 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine.
What is the SMILES notation for 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine?
The canonical SMILES for 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine is C=CCNc1c(-c2ccccc2)n(-c2c(C(C)C)cccc2C(C)C)n[n+]1-c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine?
The InChIKey is CCXBIEUZAMRUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H45N4/c1-10-22-36-35-32(27-16-12-11-13-17-27)38(33-28(23(2)3)18-14-19-29(33)24(4)5)37-39(35)34-30(25(6)7)20-15-21-31(34)26(8)9/h10-21,23-26,36H,1,22H2,2-9H3/q+1.
What are the key properties of 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine?
1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine has a molecular weight of 521.77 g/mol, XLogP of 8.91, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-phenyl-N-prop-2-enyltriazol-3-ium-4-amine is sourced from PubChem (CID 177388576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).