C23H44O7Si — CID 177388738
(E)-5-[(4S,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethyl)pent-2-enal (PubChem CID 177388738) has the molecular formula C23H44O7Si and a molecular weight of 460.68 g/mol. Its IUPAC name is (E)-5-[(4S,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethyl)pent-2-enal.
| Compound Name | (E)-5-[(4S,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethyl)pent-2-enal |
|---|---|
| PubChem CID | 177388738 |
| Molecular Formula | C23H44O7Si |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | (E)-5-[(4S,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethyl)pent-2-enal |
| SMILES | COCO[C@H](CO[Si](C)(C)C(C)(C)C)C[C@@H]1OC(C)(C)O[C@H]1CC/C(=C\C=O)COC |
| InChI | InChI=1S/C23H44O7Si/c1-22(2,3)31(8,9)28-16-19(27-17-26-7)14-21-20(29-23(4,5)30-21)11-10-18(12-13-24)15-25-6/h12-13,19-21H,10-11,14-17H2,1-9H3/b18-12+/t19-,20-,21-/m0/s1 |
| InChIKey | XWGPFVMIFQRBGI-IRMBTSHHSA-N |
| XLogP | 4.46 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|