About 1,4-bis(ethynyl)benzene;iron
1,4-bis(ethynyl)benzene;iron (PubChem CID 177388924) has the molecular formula C10H4Fe2-2
and a molecular weight of 235.83 g/mol. Its IUPAC name is 1,4-bis(ethynyl)benzene;iron.
Molecular Properties
| Compound Name | 1,4-bis(ethynyl)benzene;iron |
| PubChem CID | 177388924 |
| Molecular Formula | C10H4Fe2-2 |
| Molecular Weight | 235.83 g/mol |
| Exact Mass | 235.90 |
| IUPAC Name | 1,4-bis(ethynyl)benzene;iron |
| SMILES | [C-]#Cc1ccc(C#[C-])cc1.[Fe].[Fe] |
| InChI | InChI=1S/C10H4.2Fe/c1-3-9-5-7-10(4-2)8-6-9;;/h5-8H;;/q-2;; |
| InChIKey | KSZDTWYWPTWQRA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(ethynyl)benzene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethynyl)benzene;iron?
The IUPAC name of 1,4-bis(ethynyl)benzene;iron (CID 177388924) is 1,4-bis(ethynyl)benzene;iron.
What is the SMILES notation for 1,4-bis(ethynyl)benzene;iron?
The canonical SMILES for 1,4-bis(ethynyl)benzene;iron is [C-]#Cc1ccc(C#[C-])cc1.[Fe].[Fe].
What is the InChIKey of 1,4-bis(ethynyl)benzene;iron?
The InChIKey is KSZDTWYWPTWQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4.2Fe/c1-3-9-5-7-10(4-2)8-6-9;;/h5-8H;;/q-2;;.
What are the key properties of 1,4-bis(ethynyl)benzene;iron?
1,4-bis(ethynyl)benzene;iron has a molecular weight of 235.83 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethynyl)benzene;iron is sourced from PubChem (CID 177388924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).