About 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole
3-ethenyl-1,1-dimethyl-2,5-dihydrostannole (PubChem CID 177389165) has the molecular formula C8H14Sn
and a molecular weight of 228.91 g/mol. Its IUPAC name is 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole.
Molecular Properties
| Compound Name | 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole |
| PubChem CID | 177389165 |
| Molecular Formula | C8H14Sn |
| Molecular Weight | 228.91 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole |
| SMILES | C=CC1=CC[Sn](C)(C)C1 |
| InChI | InChI=1S/C6H8.2CH3.Sn/c1-4-6(3)5-2;;;/h4-5H,1-3H2;2*1H3;/b6-4+;;; |
| InChIKey | NZEOWJRJBGYEFI-VFKQLSEOSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole?
The IUPAC name of 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole (CID 177389165) is 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole.
What is the SMILES notation for 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole?
The canonical SMILES for 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole is C=CC1=CC[Sn](C)(C)C1.
What is the InChIKey of 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole?
The InChIKey is NZEOWJRJBGYEFI-VFKQLSEOSA-N. The full InChI is InChI=1S/C6H8.2CH3.Sn/c1-4-6(3)5-2;;;/h4-5H,1-3H2;2*1H3;/b6-4+;;;.
What are the key properties of 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole?
3-ethenyl-1,1-dimethyl-2,5-dihydrostannole has a molecular weight of 228.91 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole is sourced from PubChem (CID 177389165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).