C8H14Sn — CID 177389165
3-ethenyl-1,1-dimethyl-2,5-dihydrostannole (PubChem CID 177389165) has the molecular formula C8H14Sn and a molecular weight of 228.91 g/mol. Its IUPAC name is 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole.
| Compound Name | 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole |
|---|---|
| PubChem CID | 177389165 |
| Molecular Formula | C8H14Sn |
| Molecular Weight | 228.91 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 3-ethenyl-1,1-dimethyl-2,5-dihydrostannole |
| SMILES | C=CC1=CC[Sn](C)(C)C1 |
| InChI | InChI=1S/C6H8.2CH3.Sn/c1-4-6(3)5-2;;;/h4-5H,1-3H2;2*1H3;/b6-4+;;; |
| InChIKey | NZEOWJRJBGYEFI-VFKQLSEOSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |