C20H26N8O4 — CID 177389346
(1S)-1-[4-[(E)-[4-[(E)-[3,5-bis[(1S)-1-hydroxyethyl]-1,2,4-triazol-4-yl]iminomethyl]phenyl]methylideneamino]-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol (PubChem CID 177389346) has the molecular formula C20H26N8O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is (1S)-1-[4-[(E)-[4-[(E)-[3,5-bis[(1S)-1-hydroxyethyl]-1,2,4-triazol-4-yl]iminomethyl]phenyl]methylideneamino]-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol.
| Compound Name | (1S)-1-[4-[(E)-[4-[(E)-[3,5-bis[(1S)-1-hydroxyethyl]-1,2,4-triazol-4-yl]iminomethyl]phenyl]methylideneamino]-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol |
|---|---|
| PubChem CID | 177389346 |
| Molecular Formula | C20H26N8O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (1S)-1-[4-[(E)-[4-[(E)-[3,5-bis[(1S)-1-hydroxyethyl]-1,2,4-triazol-4-yl]iminomethyl]phenyl]methylideneamino]-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol |
| SMILES | C[C@H](O)c1nnc([C@H](C)O)n1/N=C/c1ccc(/C=N/n2c([C@H](C)O)nnc2[C@H](C)O)cc1 |
| InChI | InChI=1S/C20H26N8O4/c1-11(29)17-23-24-18(12(2)30)27(17)21-9-15-5-7-16(8-6-15)10-22-28-19(13(3)31)25-26-20(28)14(4)32/h5-14,29-32H,1-4H3/b21-9+,22-10+/t11-,12-,13-,14-/m0/s1 |
| InChIKey | LJMXSWJGHKUQBJ-OUHUYFCPSA-N |
| XLogP | 0.85 |
| TPSA | 167.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|