C18H28O5Si-2 — CID 177389563
(1E)-1-[(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyl-6-methylcyclohex-2-en-1-yl]oxybuta-1,3-diene-1,3-diolate (PubChem CID 177389563) has the molecular formula C18H28O5Si-2 and a molecular weight of 352.50 g/mol. Its IUPAC name is (1E)-1-[(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyl-6-methylcyclohex-2-en-1-yl]oxybuta-1,3-diene-1,3-diolate.
| Compound Name | (1E)-1-[(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyl-6-methylcyclohex-2-en-1-yl]oxybuta-1,3-diene-1,3-diolate |
|---|---|
| PubChem CID | 177389563 |
| Molecular Formula | C18H28O5Si-2 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (1E)-1-[(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyl-6-methylcyclohex-2-en-1-yl]oxybuta-1,3-diene-1,3-diolate |
| SMILES | C=C([O-])/C=C(\[O-])O[C@H]1C=C(C=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C18H30O5Si/c1-12(20)8-17(21)22-15-9-14(11-19)10-16(13(15)2)23-24(6,7)18(3,4)5/h8-9,11,13,15-16,20-21H,1,10H2,2-7H3/p-2/b17-8+/t13-,15+,16-/m1/s1 |
| InChIKey | ROVOZKYPUSQHBA-XIFLZLEBSA-L |
| XLogP | 2.00 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|