C23H14Cl8N2O4S4 — CID 177390471
1-chloro-4-[(1E)-3,4,4-trichloro-2-nitro-1-[3-[(1E)-3,4,4-trichloro-1-(4-chlorophenyl)sulfanyl-2-nitrobuta-1,3-dienyl]sulfanylpropylsulfanyl]buta-1,3-dienyl]sulfanylbenzene (PubChem CID 177390471) has the molecular formula C23H14Cl8N2O4S4 and a molecular weight of 794.27 g/mol. Its IUPAC name is 1-chloro-4-[(1E)-3,4,4-trichloro-2-nitro-1-[3-[(1E)-3,4,4-trichloro-1-(4-chlorophenyl)sulfanyl-2-nitrobuta-1,3-dienyl]sulfanylpropylsulfanyl]buta-1,3-dienyl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[(1E)-3,4,4-trichloro-2-nitro-1-[3-[(1E)-3,4,4-trichloro-1-(4-chlorophenyl)sulfanyl-2-nitrobuta-1,3-dienyl]sulfanylpropylsulfanyl]buta-1,3-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 177390471 |
| Molecular Formula | C23H14Cl8N2O4S4 |
| Molecular Weight | 794.27 g/mol |
| Exact Mass | 789.73 |
| IUPAC Name | 1-chloro-4-[(1E)-3,4,4-trichloro-2-nitro-1-[3-[(1E)-3,4,4-trichloro-1-(4-chlorophenyl)sulfanyl-2-nitrobuta-1,3-dienyl]sulfanylpropylsulfanyl]buta-1,3-dienyl]sulfanylbenzene |
| SMILES | O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C(\SCCCS/C(Sc1ccc(Cl)cc1)=C(/C(Cl)=C(Cl)Cl)[N+](=O)[O-])Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H14Cl8N2O4S4/c24-12-2-6-14(7-3-12)40-22(18(32(34)35)16(26)20(28)29)38-10-1-11-39-23(19(33(36)37)17(27)21(30)31)41-15-8-4-13(25)5-9-15/h2-9H,1,10-11H2/b22-18+,23-19+ |
| InChIKey | HRBQSLHORIEZEK-DPIBHUQISA-N |
| XLogP | 12.40 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.27 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|