C51H39N3O2 — CID 177390541
2-N,6-N-bis[3-(4,5-dimethylanthracen-9-yl)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 177390541) has the molecular formula C51H39N3O2 and a molecular weight of 725.89 g/mol. Its IUPAC name is 2-N,6-N-bis[3-(4,5-dimethylanthracen-9-yl)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[3-(4,5-dimethylanthracen-9-yl)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 177390541 |
| Molecular Formula | C51H39N3O2 |
| Molecular Weight | 725.89 g/mol |
| Exact Mass | 725.30 |
| IUPAC Name | 2-N,6-N-bis[3-(4,5-dimethylanthracen-9-yl)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | Cc1cccc2c(-c3cccc(NC(=O)c4cccc(C(=O)Nc5cccc(-c6c7cccc(C)c7cc7c(C)cccc67)c5)n4)c3)c3cccc(C)c3cc12 |
| InChI | InChI=1S/C51H39N3O2/c1-30-12-5-20-38-42(30)28-43-31(2)13-6-21-39(43)48(38)34-16-9-18-36(26-34)52-50(55)46-24-11-25-47(54-46)51(56)53-37-19-10-17-35(27-37)49-40-22-7-14-32(3)44(40)29-45-33(4)15-8-23-41(45)49/h5-29H,1-4H3,(H,52,55)(H,53,56) |
| InChIKey | ISGHWQZGRQSFNR-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.89 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|