About 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one
3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 177390634) has the molecular formula C24H39NO2Sn
and a molecular weight of 492.29 g/mol. Its IUPAC name is 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one |
| PubChem CID | 177390634 |
| Molecular Formula | C24H39NO2Sn |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/Cc1ccccc1)N1CCOC1=O |
| InChI | InChI=1S/C12H12NO2.3C4H9.Sn/c14-12-13(9-10-15-12)8-4-7-11-5-2-1-3-6-11;3*1-3-4-2;/h1-6H,7,9-10H2;3*1,3-4H2,2H3; |
| InChIKey | FPZCGPHTDRBIRZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one (CID 177390634) is 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one is CCCC[Sn](CCCC)(CCCC)/C(=C/Cc1ccccc1)N1CCOC1=O.
What is the InChIKey of 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one?
The InChIKey is FPZCGPHTDRBIRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NO2.3C4H9.Sn/c14-12-13(9-10-15-12)8-4-7-11-5-2-1-3-6-11;3*1-3-4-2;/h1-6H,7,9-10H2;3*1,3-4H2,2H3;.
What are the key properties of 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one?
3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one has a molecular weight of 492.29 g/mol, XLogP of 6.95, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-phenyl-1-tributylstannylprop-1-enyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 177390634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).