C24H33NO4 — CID 177390637
(2R)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]propanoic acid (PubChem CID 177390637) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is (2R)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]propanoic acid.
| Compound Name | (2R)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 177390637 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (2R)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]propanoic acid |
| SMILES | CC1=CCC[C@H]2[C@](C)(CC3=CC(=O)C(N[C@H](C)C(=O)O)=CC3=O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C24H33NO4/c1-14-7-6-8-21-23(14,4)10-9-15(2)24(21,5)13-17-11-20(27)18(12-19(17)26)25-16(3)22(28)29/h7,11-12,15-16,21,25H,6,8-10,13H2,1-5H3,(H,28,29)/t15-,16+,21+,23+,24+/m0/s1 |
| InChIKey | IVKXCFKRBRWRDF-WUECALEHSA-N |
| XLogP | 4.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|