C16H24O3Si — CID 177390848
(1'S,2'S,6'S,7'S)-1'-methyl-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 177390848) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is (1'S,2'S,6'S,7'S)-1'-methyl-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'S,2'S,6'S,7'S)-1'-methyl-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 177390848 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (1'S,2'S,6'S,7'S)-1'-methyl-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | C[C@@]12CCC3(OCCO3)[C@H]1[C@H]1C=C([Si](C)(C)C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H24O3Si/c1-15-5-6-16(18-7-8-19-16)14(15)10-9-11(20(2,3)4)13(17)12(10)15/h9-10,12,14H,5-8H2,1-4H3/t10-,12+,14-,15-/m0/s1 |
| InChIKey | XFNQHOXRDZNFFJ-FDEJFUCISA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|