C22H28O6 — CID 177391248
dimethyl (1S,2Z,4S,8E,10Z)-12-tert-butyl-9-methoxy-14-oxatricyclo[9.2.1.04,8]tetradeca-2,8,10,12-tetraene-2,3-dicarboxylate (PubChem CID 177391248) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is dimethyl (1S,2Z,4S,8E,10Z)-12-tert-butyl-9-methoxy-14-oxatricyclo[9.2.1.04,8]tetradeca-2,8,10,12-tetraene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2Z,4S,8E,10Z)-12-tert-butyl-9-methoxy-14-oxatricyclo[9.2.1.04,8]tetradeca-2,8,10,12-tetraene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 177391248 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | dimethyl (1S,2Z,4S,8E,10Z)-12-tert-butyl-9-methoxy-14-oxatricyclo[9.2.1.04,8]tetradeca-2,8,10,12-tetraene-2,3-dicarboxylate |
| SMILES | COC(=O)/C1=C(\C(=O)OC)[C@H]2CCC/C2=C(OC)/C=C2\O[C@H]1C=C2C(C)(C)C |
| InChI | InChI=1S/C22H28O6/c1-22(2,3)14-10-17-19(21(24)27-6)18(20(23)26-5)13-9-7-8-12(13)15(25-4)11-16(14)28-17/h10-11,13,17H,7-9H2,1-6H3/b15-12+,16-11+,19-18-/t13-,17-/m0/s1 |
| InChIKey | SULJUFDBVKOSCW-IZSKCXAMSA-N |
| XLogP | 3.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |