C28H26ClN2OP — CID 177392162
1-(4-chlorophenyl)-3-[3-[phenyl-(2,4,6-trimethylphenyl)phosphanyl]phenyl]urea (PubChem CID 177392162) has the molecular formula C28H26ClN2OP and a molecular weight of 472.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-[phenyl-(2,4,6-trimethylphenyl)phosphanyl]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-[phenyl-(2,4,6-trimethylphenyl)phosphanyl]phenyl]urea |
|---|---|
| PubChem CID | 177392162 |
| Molecular Formula | C28H26ClN2OP |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-[phenyl-(2,4,6-trimethylphenyl)phosphanyl]phenyl]urea |
| SMILES | Cc1cc(C)c(P(c2ccccc2)c2cccc(NC(=O)Nc3ccc(Cl)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C28H26ClN2OP/c1-19-16-20(2)27(21(3)17-19)33(25-9-5-4-6-10-25)26-11-7-8-24(18-26)31-28(32)30-23-14-12-22(29)13-15-23/h4-18H,1-3H3,(H2,30,31,32) |
| InChIKey | RGSUTPOJAFUUTL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|