C22H25NO3 — CID 177392467
(6E)-9-phenyl-2,10-dioxa-11-azabicyclo[13.4.0]nonadeca-1(19),6,15,17-tetraen-12-one (PubChem CID 177392467) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (6E)-9-phenyl-2,10-dioxa-11-azabicyclo[13.4.0]nonadeca-1(19),6,15,17-tetraen-12-one.
| Compound Name | (6E)-9-phenyl-2,10-dioxa-11-azabicyclo[13.4.0]nonadeca-1(19),6,15,17-tetraen-12-one |
|---|---|
| PubChem CID | 177392467 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (6E)-9-phenyl-2,10-dioxa-11-azabicyclo[13.4.0]nonadeca-1(19),6,15,17-tetraen-12-one |
| SMILES | O=C1CCc2ccccc2OCCC/C=C/CC(c2ccccc2)ON1 |
| InChI | InChI=1S/C22H25NO3/c24-22-16-15-19-12-7-8-13-20(19)25-17-9-2-1-6-14-21(26-23-22)18-10-4-3-5-11-18/h1,3-8,10-13,21H,2,9,14-17H2,(H,23,24)/b6-1+ |
| InChIKey | UVRLSMJGBGLTNA-LZCJLJQNSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|