C12H9N3O2 — CID 177392826
(1R,2R,5S)-2,4-dimethyl-7-oxo-6-oxabicyclo[3.2.1]oct-3-ene-1,8,8-tricarbonitrile (PubChem CID 177392826) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is (1R,2R,5S)-2,4-dimethyl-7-oxo-6-oxabicyclo[3.2.1]oct-3-ene-1,8,8-tricarbonitrile.
| Compound Name | (1R,2R,5S)-2,4-dimethyl-7-oxo-6-oxabicyclo[3.2.1]oct-3-ene-1,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 177392826 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (1R,2R,5S)-2,4-dimethyl-7-oxo-6-oxabicyclo[3.2.1]oct-3-ene-1,8,8-tricarbonitrile |
| SMILES | CC1=C[C@@H](C)[C@@]2(C#N)C(=O)O[C@@H]1C2(C#N)C#N |
| InChI | InChI=1S/C12H9N3O2/c1-7-3-8(2)12(6-15)10(16)17-9(7)11(12,4-13)5-14/h3,8-9H,1-2H3/t8-,9+,12+/m1/s1 |
| InChIKey | MZVJFQZPHQOCLA-PTRXPTGYSA-N |
| XLogP | 1.05 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|