C19H34O9 — CID 177393675
(2R,3R,4S,5S,6R)-2-[(1R,2S,3R,4R)-4-[(3S)-3,4-dihydroxybut-1-enyl]-2-hydroxy-3,5,5-trimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 177393675) has the molecular formula C19H34O9 and a molecular weight of 406.47 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(1R,2S,3R,4R)-4-[(3S)-3,4-dihydroxybut-1-enyl]-2-hydroxy-3,5,5-trimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(1R,2S,3R,4R)-4-[(3S)-3,4-dihydroxybut-1-enyl]-2-hydroxy-3,5,5-trimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 177393675 |
| Molecular Formula | C19H34O9 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1R,2S,3R,4R)-4-[(3S)-3,4-dihydroxybut-1-enyl]-2-hydroxy-3,5,5-trimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C[C@H]1[C@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC(C)(C)[C@@H]1C=C[C@H](O)CO |
| InChI | InChI=1S/C19H34O9/c1-9-11(5-4-10(22)7-20)19(2,3)6-12(14(9)23)27-18-17(26)16(25)15(24)13(8-21)28-18/h4-5,9-18,20-26H,6-8H2,1-3H3/t9-,10+,11-,12-,13-,14+,15-,16+,17-,18-/m1/s1 |
| InChIKey | QVJBQZBBHBTJII-FHNYSYIBSA-N |
| XLogP | -1.88 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|