C11H12O3 — CID 177393956
7-methoxy-2-methylidene-3,4-dihydrochromen-4-ol (PubChem CID 177393956) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 7-methoxy-2-methylidene-3,4-dihydrochromen-4-ol.
| Compound Name | 7-methoxy-2-methylidene-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 177393956 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 7-methoxy-2-methylidene-3,4-dihydrochromen-4-ol |
| SMILES | C=C1CC(O)c2ccc(OC)cc2O1 |
| InChI | InChI=1S/C11H12O3/c1-7-5-10(12)9-4-3-8(13-2)6-11(9)14-7/h3-4,6,10,12H,1,5H2,2H3 |
| InChIKey | FUXUNCUGGLVVJQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |