C19H18O3S2 — CID 177393995
(1R,2S,3S,4R,6S,7R)-1-(benzenesulfonyl)-7-phenylsulfanyltricyclo[2.2.1.02,6]heptan-3-ol (PubChem CID 177393995) has the molecular formula C19H18O3S2 and a molecular weight of 358.48 g/mol. Its IUPAC name is (1R,2S,3S,4R,6S,7R)-1-(benzenesulfonyl)-7-phenylsulfanyltricyclo[2.2.1.02,6]heptan-3-ol.
| Compound Name | (1R,2S,3S,4R,6S,7R)-1-(benzenesulfonyl)-7-phenylsulfanyltricyclo[2.2.1.02,6]heptan-3-ol |
|---|---|
| PubChem CID | 177393995 |
| Molecular Formula | C19H18O3S2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (1R,2S,3S,4R,6S,7R)-1-(benzenesulfonyl)-7-phenylsulfanyltricyclo[2.2.1.02,6]heptan-3-ol |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12[C@@H]3[C@@H](O)[C@@H](C[C@@H]31)[C@H]2Sc1ccccc1 |
| InChI | InChI=1S/C19H18O3S2/c20-17-14-11-15-16(17)19(15,18(14)23-12-7-3-1-4-8-12)24(21,22)13-9-5-2-6-10-13/h1-10,14-18,20H,11H2/t14-,15+,16+,17+,18-,19-/m1/s1 |
| InChIKey | YDQAYCSSSUDAOT-GFAIHXBESA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |