C32H34FNO4 — CID 177394409
dimethyl 1-benzyl-7-fluoro-10,10-dimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate (PubChem CID 177394409) has the molecular formula C32H34FNO4 and a molecular weight of 515.63 g/mol. Its IUPAC name is dimethyl 1-benzyl-7-fluoro-10,10-dimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-7-fluoro-10,10-dimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 177394409 |
| Molecular Formula | C32H34FNO4 |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | dimethyl 1-benzyl-7-fluoro-10,10-dimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2Cc3cc(F)ccc3C(C)(C)C2N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C32H34FNO4/c1-31(2)26-16-15-25(33)18-23(26)17-24-19-32(29(35)37-3,30(36)38-4)28(22-13-9-6-10-14-22)34(27(24)31)20-21-11-7-5-8-12-21/h5-16,18,24,27-28H,17,19-20H2,1-4H3 |
| InChIKey | LXIBKXUUHONRHX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|