C19H30O9 — CID 177394638
(1Z)-1-[(2S,4S)-2-hydroxy-2,6,6-trimethyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]butane-2,3-dione (PubChem CID 177394638) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is (1Z)-1-[(2S,4S)-2-hydroxy-2,6,6-trimethyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]butane-2,3-dione.
| Compound Name | (1Z)-1-[(2S,4S)-2-hydroxy-2,6,6-trimethyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]butane-2,3-dione |
|---|---|
| PubChem CID | 177394638 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (1Z)-1-[(2S,4S)-2-hydroxy-2,6,6-trimethyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]butane-2,3-dione |
| SMILES | CC(=O)C(=O)/C=C1/C(C)(C)C[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C[C@]1(C)O |
| InChI | InChI=1S/C19H30O9/c1-9(21)11(22)5-13-18(2,3)6-10(7-19(13,4)26)27-17-16(25)15(24)14(23)12(8-20)28-17/h5,10,12,14-17,20,23-26H,6-8H2,1-4H3/b13-5-/t10-,12+,14+,15-,16+,17+,19-/m0/s1 |
| InChIKey | RPSZPCCUDXHDDG-VSUTXGPQSA-N |
| XLogP | -1.17 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|