About 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one
7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one (PubChem CID 177394677) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one.
Molecular Properties
| Compound Name | 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one |
| PubChem CID | 177394677 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one |
| SMILES | C=CC(C)(C)C(C)(N)CCOc1ccc2nc3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C21H24N2O3/c1-5-20(2,3)21(4,22)10-11-25-15-7-9-17-19(13-15)26-18-12-14(24)6-8-16(18)23-17/h5-9,12-13H,1,10-11,22H2,2-4H3 |
| InChIKey | HYUCOEWICWZYSF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one?
The IUPAC name of 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one (CID 177394677) is 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one.
What is the SMILES notation for 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one?
The canonical SMILES for 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one is C=CC(C)(C)C(C)(N)CCOc1ccc2nc3ccc(=O)cc-3oc2c1.
What is the InChIKey of 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one?
The InChIKey is HYUCOEWICWZYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-5-20(2,3)21(4,22)10-11-25-15-7-9-17-19(13-15)26-18-12-14(24)6-8-16(18)23-17/h5-9,12-13H,1,10-11,22H2,2-4H3.
What are the key properties of 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one?
7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one has a molecular weight of 352.43 g/mol, XLogP of 3.99, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-amino-3,4,4-trimethylhex-5-enoxy)phenoxazin-3-one is sourced from PubChem (CID 177394677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).