C28H12S12 — CID 177394806
2-(1,3-dithiol-2-ylidene)-5-[2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole (PubChem CID 177394806) has the molecular formula C28H12S12 and a molecular weight of 733.21 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-5-[2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole.
| Compound Name | 2-(1,3-dithiol-2-ylidene)-5-[2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole |
|---|---|
| PubChem CID | 177394806 |
| Molecular Formula | C28H12S12 |
| Molecular Weight | 733.21 g/mol |
| Exact Mass | 731.76 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-5-[2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole |
| SMILES | C1=CSC(=C2SC3=C(S2)SC(=C2SC4=C(S2)SC(=c2c5ccccc5c(=C5SC=CS5)c5ccccc25)S4)S3)S1 |
| InChI | InChI=1S/C28H12S12/c1-3-7-15-13(5-1)17(19-29-9-10-30-19)14-6-2-4-8-16(14)18(15)20-33-23-24(34-20)38-27(37-23)28-39-25-26(40-28)36-22(35-25)21-31-11-12-32-21/h1-12H |
| InChIKey | XLWWABHLHUJVOK-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.21 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|