About 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride
4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride (PubChem CID 177394884) has the molecular formula C20H12FNO5S
and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride |
| PubChem CID | 177394884 |
| Molecular Formula | C20H12FNO5S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride |
| SMILES | Nc1c(-c2ccc(S(=O)(=O)F)cc2)cc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H12FNO5S/c21-28(26,27)11-7-5-10(6-8-11)14-9-15(23)16-17(18(14)22)20(25)13-4-2-1-3-12(13)19(16)24/h1-9,23H,22H2 |
| InChIKey | LQLXCALHPYXHHD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride?
The IUPAC name of 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride (CID 177394884) is 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride.
What is the SMILES notation for 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride?
The canonical SMILES for 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride is Nc1c(-c2ccc(S(=O)(=O)F)cc2)cc(O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride?
The InChIKey is LQLXCALHPYXHHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12FNO5S/c21-28(26,27)11-7-5-10(6-8-11)14-9-15(23)16-17(18(14)22)20(25)13-4-2-1-3-12(13)19(16)24/h1-9,23H,22H2.
What are the key properties of 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride?
4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride has a molecular weight of 397.38 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonyl fluoride is sourced from PubChem (CID 177394884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).