C54H72N6 — CID 177394887
3,4-diethyl-1-[2,3,4,5,6-pentakis(3,4-diethylpyrrol-1-yl)phenyl]pyrrole (PubChem CID 177394887) has the molecular formula C54H72N6 and a molecular weight of 805.21 g/mol. Its IUPAC name is 3,4-diethyl-1-[2,3,4,5,6-pentakis(3,4-diethylpyrrol-1-yl)phenyl]pyrrole.
| Compound Name | 3,4-diethyl-1-[2,3,4,5,6-pentakis(3,4-diethylpyrrol-1-yl)phenyl]pyrrole |
|---|---|
| PubChem CID | 177394887 |
| Molecular Formula | C54H72N6 |
| Molecular Weight | 805.21 g/mol |
| Exact Mass | 804.58 |
| IUPAC Name | 3,4-diethyl-1-[2,3,4,5,6-pentakis(3,4-diethylpyrrol-1-yl)phenyl]pyrrole |
| SMILES | CCc1cn(-c2c(-n3cc(CC)c(CC)c3)c(-n3cc(CC)c(CC)c3)c(-n3cc(CC)c(CC)c3)c(-n3cc(CC)c(CC)c3)c2-n2cc(CC)c(CC)c2)cc1CC |
| InChI | InChI=1S/C54H72N6/c1-13-37-25-55(26-38(37)14-2)49-50(56-27-39(15-3)40(16-4)28-56)52(58-31-43(19-7)44(20-8)32-58)54(60-35-47(23-11)48(24-12)36-60)53(59-33-45(21-9)46(22-10)34-59)51(49)57-29-41(17-5)42(18-6)30-57/h25-36H,13-24H2,1-12H3 |
| InChIKey | SORLUBGEMDFXIK-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 29.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.21 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |