C44H36O12 — CID 177395716
methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-(naphthalen-1-ylmethoxy)-2-[4-(naphthalen-1-ylmethoxy)phenyl]-4-oxochromen-7-yl]oxyoxane-2-carboxylate (PubChem CID 177395716) has the molecular formula C44H36O12 and a molecular weight of 756.76 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-(naphthalen-1-ylmethoxy)-2-[4-(naphthalen-1-ylmethoxy)phenyl]-4-oxochromen-7-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-(naphthalen-1-ylmethoxy)-2-[4-(naphthalen-1-ylmethoxy)phenyl]-4-oxochromen-7-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 177395716 |
| Molecular Formula | C44H36O12 |
| Molecular Weight | 756.76 g/mol |
| Exact Mass | 756.22 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-(naphthalen-1-ylmethoxy)-2-[4-(naphthalen-1-ylmethoxy)phenyl]-4-oxochromen-7-yl]oxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc3oc(-c4ccc(OCc5cccc6ccccc56)cc4)cc(=O)c3c(O)c2OCc2cccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C44H36O12/c1-51-43(50)42-39(48)38(47)40(49)44(56-42)55-35-21-34-36(37(46)41(35)53-23-28-13-7-11-25-9-3-5-15-31(25)28)32(45)20-33(54-34)26-16-18-29(19-17-26)52-22-27-12-6-10-24-8-2-4-14-30(24)27/h2-21,38-40,42,44,46-49H,22-23H2,1H3/t38-,39-,40+,42-,44+/m0/s1 |
| InChIKey | MDFGQDYFZQRPFX-QYNZVJCUSA-N |
| XLogP | 5.99 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.76 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |