About 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid
3-methylcyclopenta-1,2,4-triene-1-carboxylic acid (PubChem CID 177396230) has the molecular formula C7H6O2
and a molecular weight of 122.12 g/mol. Its IUPAC name is 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid |
| PubChem CID | 177396230 |
| Molecular Formula | C7H6O2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid |
| SMILES | CC1=C=C(C(=O)O)C=C1 |
| InChI | InChI=1S/C7H6O2/c1-5-2-3-6(4-5)7(8)9/h2-3H,1H3,(H,8,9) |
| InChIKey | ULZPOAUECCBLPH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid?
The IUPAC name of 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid (CID 177396230) is 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid.
What is the SMILES notation for 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid?
The canonical SMILES for 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid is CC1=C=C(C(=O)O)C=C1.
What is the InChIKey of 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid?
The InChIKey is ULZPOAUECCBLPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2/c1-5-2-3-6(4-5)7(8)9/h2-3H,1H3,(H,8,9).
What are the key properties of 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid?
3-methylcyclopenta-1,2,4-triene-1-carboxylic acid has a molecular weight of 122.12 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopenta-1,2,4-triene-1-carboxylic acid is sourced from PubChem (CID 177396230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).