C16H19NO2 — CID 177396239
(1R,12S,16R)-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-trien-10-one (PubChem CID 177396239) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (1R,12S,16R)-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-trien-10-one.
| Compound Name | (1R,12S,16R)-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-trien-10-one |
|---|---|
| PubChem CID | 177396239 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1R,12S,16R)-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-trien-10-one |
| SMILES | COc1ccc2c(c1)CN1C(=O)C[C@@H]3CCC[C@H]2[C@@H]31 |
| InChI | InChI=1S/C16H19NO2/c1-19-12-5-6-13-11(7-12)9-17-15(18)8-10-3-2-4-14(13)16(10)17/h5-7,10,14,16H,2-4,8-9H2,1H3/t10-,14+,16+/m0/s1 |
| InChIKey | JYIITDNMDDKYLA-DRZCJDIDSA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |