C24H36N4O6 — CID 177396254
tert-butyl (14S)-14-amino-2-[(4-hydroxyphenyl)methyl]-3,11,15-trioxo-1,4,10-triazacyclopentadecane-5-carboxylate (PubChem CID 177396254) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is tert-butyl (14S)-14-amino-2-[(4-hydroxyphenyl)methyl]-3,11,15-trioxo-1,4,10-triazacyclopentadecane-5-carboxylate.
| Compound Name | tert-butyl (14S)-14-amino-2-[(4-hydroxyphenyl)methyl]-3,11,15-trioxo-1,4,10-triazacyclopentadecane-5-carboxylate |
|---|---|
| PubChem CID | 177396254 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | tert-butyl (14S)-14-amino-2-[(4-hydroxyphenyl)methyl]-3,11,15-trioxo-1,4,10-triazacyclopentadecane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCCNC(=O)CC[C@H](N)C(=O)NC(Cc2ccc(O)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H36N4O6/c1-24(2,3)34-23(33)18-6-4-5-13-26-20(30)12-11-17(25)21(31)28-19(22(32)27-18)14-15-7-9-16(29)10-8-15/h7-10,17-19,29H,4-6,11-14,25H2,1-3H3,(H,26,30)(H,27,32)(H,28,31)/t17-,18?,19?/m0/s1 |
| InChIKey | FJRKJUXCZZROKG-VIQWUECVSA-N |
| XLogP | 0.65 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |