C20H18BF2N3O — CID 177396714
(2E)-2-[(6-difluoroboranyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]imidazo[1,2-a]pyridin-3-one (PubChem CID 177396714) has the molecular formula C20H18BF2N3O and a molecular weight of 365.19 g/mol. Its IUPAC name is (2E)-2-[(6-difluoroboranyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]imidazo[1,2-a]pyridin-3-one.
| Compound Name | (2E)-2-[(6-difluoroboranyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]imidazo[1,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 177396714 |
| Molecular Formula | C20H18BF2N3O |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2E)-2-[(6-difluoroboranyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]imidazo[1,2-a]pyridin-3-one |
| SMILES | O=C1/C(=C\c2cc3c4c(c2B(F)F)CCCN4CCC3)N=C2C=CC=CN12 |
| InChI | InChI=1S/C20H18BF2N3O/c22-21(23)18-14(12-16-20(27)26-10-2-1-7-17(26)24-16)11-13-5-3-8-25-9-4-6-15(18)19(13)25/h1-2,7,10-12H,3-6,8-9H2/b16-12+ |
| InChIKey | DPSIJJUXQABCIA-FOWTUZBSSA-N |
| XLogP | 2.68 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|