C10H12O2 — CID 177397056
(1S,3S,6R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene (PubChem CID 177397056) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (1S,3S,6R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene.
| Compound Name | (1S,3S,6R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene |
|---|---|
| PubChem CID | 177397056 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (1S,3S,6R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene |
| SMILES | C1C[C@H]2O[C@@H]1C1=C2[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C10H12O2/c1-2-6-10-8-4-3-7(12-8)9(10)5(1)11-6/h5-8H,1-4H2/t5-,6+,7-,8+ |
| InChIKey | RFMCQGAFBDUWBW-KVFPUHGPSA-N |
| XLogP | 1.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|