C25H24O2 — CID 177397823
ethyl (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enoate (PubChem CID 177397823) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 177397823 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C(/c1ccccc1)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24O2/c1-4-27-25(26)24(22-16-12-19(3)13-17-22)23(20-8-6-5-7-9-20)21-14-10-18(2)11-15-21/h5-17H,4H2,1-3H3/b24-23- |
| InChIKey | KASVNFOFYFVXBB-VHXPQNKSSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|