C36H36N2O4 — CID 177398039
ethyl (1R,2R,10S,11S,13R)-13-methyl-9-[[4-(1-methylindol-2-yl)phenyl]methyl]-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate (PubChem CID 177398039) has the molecular formula C36H36N2O4 and a molecular weight of 560.69 g/mol. Its IUPAC name is ethyl (1R,2R,10S,11S,13R)-13-methyl-9-[[4-(1-methylindol-2-yl)phenyl]methyl]-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate.
| Compound Name | ethyl (1R,2R,10S,11S,13R)-13-methyl-9-[[4-(1-methylindol-2-yl)phenyl]methyl]-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate |
|---|---|
| PubChem CID | 177398039 |
| Molecular Formula | C36H36N2O4 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | ethyl (1R,2R,10S,11S,13R)-13-methyl-9-[[4-(1-methylindol-2-yl)phenyl]methyl]-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@]3(CCCC[C@@]3(C)C1=O)[C@@H]1c3ccccc3N(Cc3ccc(-c4cc5ccccc5n4C)cc3)[C@@H]12 |
| InChI | InChI=1S/C36H36N2O4/c1-4-41-33(40)36-31-30(35(42-36)20-10-9-19-34(35,2)32(36)39)26-12-6-8-14-28(26)38(31)22-23-15-17-24(18-16-23)29-21-25-11-5-7-13-27(25)37(29)3/h5-8,11-18,21,30-31H,4,9-10,19-20,22H2,1-3H3/t30-,31+,34+,35-,36+/m1/s1 |
| InChIKey | WEDLNOPHOGVXRY-XHJRGXQRSA-N |
| XLogP | 6.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|