C24H30N8 — CID 177398047
N-[6-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]-1,10-phenanthrolin-5-yl]-1,3-dimethyl-1,3-diazinan-2-imine (PubChem CID 177398047) has the molecular formula C24H30N8 and a molecular weight of 430.56 g/mol. Its IUPAC name is N-[6-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]-1,10-phenanthrolin-5-yl]-1,3-dimethyl-1,3-diazinan-2-imine.
| Compound Name | N-[6-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]-1,10-phenanthrolin-5-yl]-1,3-dimethyl-1,3-diazinan-2-imine |
|---|---|
| PubChem CID | 177398047 |
| Molecular Formula | C24H30N8 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N-[6-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]-1,10-phenanthrolin-5-yl]-1,3-dimethyl-1,3-diazinan-2-imine |
| SMILES | CN1CCCN(C)C1=Nc1c(N=C2N(C)CCCN2C)c2cccnc2c2ncccc12 |
| InChI | InChI=1S/C24H30N8/c1-29-13-7-14-30(2)23(29)27-21-17-9-5-11-25-19(17)20-18(10-6-12-26-20)22(21)28-24-31(3)15-8-16-32(24)4/h5-6,9-12H,7-8,13-16H2,1-4H3 |
| InChIKey | YULFBONUBNGDRB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|