C19H23NO3 — CID 177398306
(6R,9S,13S,14R,16R,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-3,12,18-trione (PubChem CID 177398306) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (6R,9S,13S,14R,16R,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-3,12,18-trione.
| Compound Name | (6R,9S,13S,14R,16R,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-3,12,18-trione |
|---|---|
| PubChem CID | 177398306 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (6R,9S,13S,14R,16R,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-3,12,18-trione |
| SMILES | C[C@@H]1C(=O)N2C[C@H]3CC[C@@H]4CCC(=O)C4=C4C(=O)[C@@H]1C[C@@H]2[C@]43C |
| InChI | InChI=1S/C19H23NO3/c1-9-12-7-14-19(2)11(8-20(14)18(9)23)5-3-10-4-6-13(21)15(10)16(19)17(12)22/h9-12,14H,3-8H2,1-2H3/t9-,10+,11+,12+,14+,19+/m0/s1 |
| InChIKey | XUCCFCBJPCBNRD-FEIYLPNISA-N |
| XLogP | 2.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |