C17H30O2Si — CID 177398534
(1R,2Z,4S,7R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7-ethenylbicyclo[2.2.1]heptan-7-ol (PubChem CID 177398534) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (1R,2Z,4S,7R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7-ethenylbicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1R,2Z,4S,7R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7-ethenylbicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 177398534 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (1R,2Z,4S,7R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7-ethenylbicyclo[2.2.1]heptan-7-ol |
| SMILES | C=C[C@@]1(O)[C@H]2CC[C@@H]1/C(=C\CO[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C17H30O2Si/c1-7-17(18)14-8-9-15(17)13(12-14)10-11-19-20(5,6)16(2,3)4/h7,10,14-15,18H,1,8-9,11-12H2,2-6H3/b13-10-/t14-,15+,17+/m0/s1 |
| InChIKey | CNCXWYCXTLBYKK-KPXKOICKSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|