C21H38CrO4Si — CID 177398602
[(4aR,7R,8R,8aR)-2,2-dimethyl-7-prop-2-enyl-8-tri(propan-2-yl)silyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ylidene]chromium (PubChem CID 177398602) has the molecular formula C21H38CrO4Si and a molecular weight of 434.61 g/mol. Its IUPAC name is [(4aR,7R,8R,8aR)-2,2-dimethyl-7-prop-2-enyl-8-tri(propan-2-yl)silyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ylidene]chromium.
| Compound Name | [(4aR,7R,8R,8aR)-2,2-dimethyl-7-prop-2-enyl-8-tri(propan-2-yl)silyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ylidene]chromium |
|---|---|
| PubChem CID | 177398602 |
| Molecular Formula | C21H38CrO4Si |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(4aR,7R,8R,8aR)-2,2-dimethyl-7-prop-2-enyl-8-tri(propan-2-yl)silyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ylidene]chromium |
| SMILES | C=CC[C@H]1C(=[Cr])O[C@@H]2COC(C)(C)O[C@H]2[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O4Si.Cr/c1-10-11-17-12-22-18-13-23-21(8,9)24-20(18)19(17)25-26(14(2)3,15(4)5)16(6)7;/h10,14-20H,1,11,13H2,2-9H3;/t17-,18+,19+,20+;/m0./s1 |
| InChIKey | CJDJJBOKPQBVBI-PFGQKEBJSA-N |
| XLogP | 4.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|