C50H80O10 — CID 177399053
(3Z,5Z,7E,13E,15E,17E)-5,9,15,19-tetraethyl-10,20-bis[4-(5-ethyl-4-hydroxy-6-methyloxan-2-yl)-3-hydroxybutan-2-yl]-1,11-dioxacycloicosa-3,5,7,13,15,17-hexaene-2,12-dione (PubChem CID 177399053) has the molecular formula C50H80O10 and a molecular weight of 841.18 g/mol. Its IUPAC name is (3Z,5Z,7E,13E,15E,17E)-5,9,15,19-tetraethyl-10,20-bis[4-(5-ethyl-4-hydroxy-6-methyloxan-2-yl)-3-hydroxybutan-2-yl]-1,11-dioxacycloicosa-3,5,7,13,15,17-hexaene-2,12-dione.
| Compound Name | (3Z,5Z,7E,13E,15E,17E)-5,9,15,19-tetraethyl-10,20-bis[4-(5-ethyl-4-hydroxy-6-methyloxan-2-yl)-3-hydroxybutan-2-yl]-1,11-dioxacycloicosa-3,5,7,13,15,17-hexaene-2,12-dione |
|---|---|
| PubChem CID | 177399053 |
| Molecular Formula | C50H80O10 |
| Molecular Weight | 841.18 g/mol |
| Exact Mass | 840.58 |
| IUPAC Name | (3Z,5Z,7E,13E,15E,17E)-5,9,15,19-tetraethyl-10,20-bis[4-(5-ethyl-4-hydroxy-6-methyloxan-2-yl)-3-hydroxybutan-2-yl]-1,11-dioxacycloicosa-3,5,7,13,15,17-hexaene-2,12-dione |
| SMILES | CCC1=C/C=C/C(CC)C(C(C)C(O)CC2CC(O)C(CC)C(C)O2)OC(=O)/C=C/C(CC)=C/C=C/C(CC)C(C(C)C(O)CC2CC(O)C(CC)C(C)O2)OC(=O)/C=C\1 |
| InChI | InChI=1S/C50H80O10/c1-11-35-19-17-21-37(13-3)49(31(7)43(51)27-39-29-45(53)41(15-5)33(9)57-39)60-48(56)26-24-36(12-2)20-18-22-38(14-4)50(59-47(55)25-23-35)32(8)44(52)28-40-30-46(54)42(16-6)34(10)58-40/h17-26,31-34,37-46,49-54H,11-16,27-30H2,1-10H3/b21-17+,22-18+,25-23-,26-24+,35-19-,36-20+ |
| InChIKey | STVLEPUCTJHSNJ-LAZLVTQSSA-N |
| XLogP | 8.68 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.18 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |