C19H30O4Si — CID 177400005
methyl (2E,4E,6Z,8E)-10-(oxan-2-yloxy)-6-trimethylsilyldeca-2,4,6,8-tetraenoate (PubChem CID 177400005) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is methyl (2E,4E,6Z,8E)-10-(oxan-2-yloxy)-6-trimethylsilyldeca-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6Z,8E)-10-(oxan-2-yloxy)-6-trimethylsilyldeca-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 177400005 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | methyl (2E,4E,6Z,8E)-10-(oxan-2-yloxy)-6-trimethylsilyldeca-2,4,6,8-tetraenoate |
| SMILES | COC(=O)/C=C/C=C/C(=C/C=C/COC1CCCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C19H30O4Si/c1-21-18(20)13-6-5-11-17(24(2,3)4)12-7-9-15-22-19-14-8-10-16-23-19/h5-7,9,11-13,19H,8,10,14-16H2,1-4H3/b9-7+,11-5+,13-6+,17-12- |
| InChIKey | UCFUHMFDKKAGFV-VFGZKERDSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|