About 3-aminopropyl N-quinolin-2-ylcarbamate
3-aminopropyl N-quinolin-2-ylcarbamate (PubChem CID 177400017) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-aminopropyl N-quinolin-2-ylcarbamate.
Molecular Properties
| Compound Name | 3-aminopropyl N-quinolin-2-ylcarbamate |
| PubChem CID | 177400017 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-aminopropyl N-quinolin-2-ylcarbamate |
| SMILES | NCCCOC(=O)Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C13H15N3O2/c14-8-3-9-18-13(17)16-12-7-6-10-4-1-2-5-11(10)15-12/h1-2,4-7H,3,8-9,14H2,(H,15,16,17) |
| InChIKey | IWNYICTZZACLNQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl N-quinolin-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl N-quinolin-2-ylcarbamate?
The IUPAC name of 3-aminopropyl N-quinolin-2-ylcarbamate (CID 177400017) is 3-aminopropyl N-quinolin-2-ylcarbamate.
What is the SMILES notation for 3-aminopropyl N-quinolin-2-ylcarbamate?
The canonical SMILES for 3-aminopropyl N-quinolin-2-ylcarbamate is NCCCOC(=O)Nc1ccc2ccccc2n1.
What is the InChIKey of 3-aminopropyl N-quinolin-2-ylcarbamate?
The InChIKey is IWNYICTZZACLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c14-8-3-9-18-13(17)16-12-7-6-10-4-1-2-5-11(10)15-12/h1-2,4-7H,3,8-9,14H2,(H,15,16,17).
What are the key properties of 3-aminopropyl N-quinolin-2-ylcarbamate?
3-aminopropyl N-quinolin-2-ylcarbamate has a molecular weight of 245.28 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl N-quinolin-2-ylcarbamate is sourced from PubChem (CID 177400017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).