About CID 177400061
CID 177400061 (PubChem CID 177400061) has the molecular formula C27H24N8Tl2
and a molecular weight of 869.31 g/mol.
Molecular Properties
| Compound Name | CID 177400061 |
| PubChem CID | 177400061 |
| Molecular Formula | C27H24N8Tl2 |
| Molecular Weight | 869.31 g/mol |
| Exact Mass | 870.16 |
| IUPAC Name | — |
| SMILES | C(c1nnn[nH]1)c1nnn[nH]1.c1ccc([Tl]c2ccccc2)cc1.c1ccc([Tl]c2ccccc2)cc1 |
| InChI | InChI=1S/4C6H5.C3H4N8.2Tl/c4*1-2-4-6-5-3-1;1(2-4-8-9-5-2)3-6-10-11-7-3;;/h4*1-5H;1H2,(H,4,5,8,9)(H,6,7,10,11);; |
| InChIKey | HGGKXZHEOGKMSH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 869.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 177400061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177400061?
The IUPAC name of CID 177400061 (CID 177400061) is not available.
What is the SMILES notation for CID 177400061?
The canonical SMILES for CID 177400061 is C(c1nnn[nH]1)c1nnn[nH]1.c1ccc([Tl]c2ccccc2)cc1.c1ccc([Tl]c2ccccc2)cc1.
What is the InChIKey of CID 177400061?
The InChIKey is HGGKXZHEOGKMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H5.C3H4N8.2Tl/c4*1-2-4-6-5-3-1;1(2-4-8-9-5-2)3-6-10-11-7-3;;/h4*1-5H;1H2,(H,4,5,8,9)(H,6,7,10,11);;.
What are the key properties of CID 177400061?
CID 177400061 has a molecular weight of 869.31 g/mol, XLogP of 0.99, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177400061 is sourced from PubChem (CID 177400061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).