C20H19NO4 — CID 177400306
ethyl (E)-3-hydroxy-2-(2-methyl-4-naphthalen-2-yl-1,3-oxazol-5-yl)but-2-enoate (PubChem CID 177400306) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-(2-methyl-4-naphthalen-2-yl-1,3-oxazol-5-yl)but-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-2-(2-methyl-4-naphthalen-2-yl-1,3-oxazol-5-yl)but-2-enoate |
|---|---|
| PubChem CID | 177400306 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-(2-methyl-4-naphthalen-2-yl-1,3-oxazol-5-yl)but-2-enoate |
| SMILES | CCOC(=O)/C(=C(\C)O)c1oc(C)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19NO4/c1-4-24-20(23)17(12(2)22)19-18(21-13(3)25-19)16-10-9-14-7-5-6-8-15(14)11-16/h5-11,22H,4H2,1-3H3/b17-12+ |
| InChIKey | YLWZYWKNVPZMAB-SFQUDFHCSA-N |
| XLogP | 4.66 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|