C20H18O5 — CID 177400461
(1S,12S)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene-1,16-diol (PubChem CID 177400461) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (1S,12S)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene-1,16-diol.
| Compound Name | (1S,12S)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene-1,16-diol |
|---|---|
| PubChem CID | 177400461 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (1S,12S)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene-1,16-diol |
| SMILES | C=C(C)C1Cc2c(ccc3c2O[C@H]2c4ccc(O)cc4OC[C@@]32O)O1 |
| InChI | InChI=1S/C20H18O5/c1-10(2)16-8-13-15(24-16)6-5-14-18(13)25-19-12-4-3-11(21)7-17(12)23-9-20(14,19)22/h3-7,16,19,21-22H,1,8-9H2,2H3/t16?,19-,20+/m0/s1 |
| InChIKey | HMRUPQQCXBPLCF-KHMGXFTDSA-N |
| XLogP | 2.99 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|