C52H56N2 — CID 177401262
[3-(3,5-ditert-butylbenzenecarboximidoyl)-2-pyren-2-ylphenyl]-(3,5-ditert-butylphenyl)methanimine (PubChem CID 177401262) has the molecular formula C52H56N2 and a molecular weight of 709.03 g/mol. Its IUPAC name is [3-(3,5-ditert-butylbenzenecarboximidoyl)-2-pyren-2-ylphenyl]-(3,5-ditert-butylphenyl)methanimine.
| Compound Name | [3-(3,5-ditert-butylbenzenecarboximidoyl)-2-pyren-2-ylphenyl]-(3,5-ditert-butylphenyl)methanimine |
|---|---|
| PubChem CID | 177401262 |
| Molecular Formula | C52H56N2 |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.44 |
| IUPAC Name | [3-(3,5-ditert-butylbenzenecarboximidoyl)-2-pyren-2-ylphenyl]-(3,5-ditert-butylphenyl)methanimine |
| SMILES | [H]/N=C(\c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cccc(/C(=N/[H])c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1-c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C52H56N2/c1-49(2,3)38-25-36(26-39(29-38)50(4,5)6)47(53)42-17-14-18-43(48(54)37-27-40(51(7,8)9)30-41(28-37)52(10,11)12)46(42)35-23-33-21-19-31-15-13-16-32-20-22-34(24-35)45(33)44(31)32/h13-30,53-54H,1-12H3/b53-47+,54-48+ |
| InChIKey | JVDVAFUXCULQJJ-WALHYFOXSA-N |
| XLogP | 14.27 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|