About (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol
(1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol (PubChem CID 177401290) has the molecular formula C17H30OS
and a molecular weight of 282.49 g/mol. Its IUPAC name is (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol.
Molecular Properties
| Compound Name | (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol |
| PubChem CID | 177401290 |
| Molecular Formula | C17H30OS |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol |
| SMILES | C=C(/C=C\CCCCC)C(O)/C=C/SCCCCC |
| InChI | InChI=1S/C17H30OS/c1-4-6-8-9-10-12-16(3)17(18)13-15-19-14-11-7-5-2/h10,12-13,15,17-18H,3-9,11,14H2,1-2H3/b12-10-,15-13+ |
| InChIKey | PFCSXOJJOQSOSZ-WTTHNMJSSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol?
The IUPAC name of (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol (CID 177401290) is (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol.
What is the SMILES notation for (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol?
The canonical SMILES for (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol is C=C(/C=C\CCCCC)C(O)/C=C/SCCCCC.
What is the InChIKey of (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol?
The InChIKey is PFCSXOJJOQSOSZ-WTTHNMJSSA-N. The full InChI is InChI=1S/C17H30OS/c1-4-6-8-9-10-12-16(3)17(18)13-15-19-14-11-7-5-2/h10,12-13,15,17-18H,3-9,11,14H2,1-2H3/b12-10-,15-13+.
What are the key properties of (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol?
(1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol has a molecular weight of 282.49 g/mol, XLogP of 5.48, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,5Z)-4-methylidene-1-pentylsulfanylundeca-1,5-dien-3-ol is sourced from PubChem (CID 177401290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).