C26H28N2O8 — CID 177401928
N-[3-[[6-[3-[(E)-benzylidene(oxido)azaniumyl]propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-oxopropyl]-1-phenylmethanimine oxide (PubChem CID 177401928) has the molecular formula C26H28N2O8 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-[3-[[6-[3-[(E)-benzylidene(oxido)azaniumyl]propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-oxopropyl]-1-phenylmethanimine oxide.
| Compound Name | N-[3-[[6-[3-[(E)-benzylidene(oxido)azaniumyl]propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-oxopropyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 177401928 |
| Molecular Formula | C26H28N2O8 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[3-[[6-[3-[(E)-benzylidene(oxido)azaniumyl]propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-oxopropyl]-1-phenylmethanimine oxide |
| SMILES | O=C(CC/[N+]([O-])=C/c1ccccc1)OC1COC2C(OC(=O)CC/[N+]([O-])=C\c3ccccc3)COC12 |
| InChI | InChI=1S/C26H28N2O8/c29-23(11-13-27(31)15-19-7-3-1-4-8-19)35-21-17-33-26-22(18-34-25(21)26)36-24(30)12-14-28(32)16-20-9-5-2-6-10-20/h1-10,15-16,21-22,25-26H,11-14,17-18H2/b27-15-,28-16+ |
| InChIKey | AHCFRKMCQRYYFF-XFPKHNAPSA-N |
| XLogP | 1.65 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|