C24H40BBrO2 — CID 177401957
2-(2-bromophenyl)-4,4,5,5-tetrakis(2-methylpropyl)-1,3,2-dioxaborolane (PubChem CID 177401957) has the molecular formula C24H40BBrO2 and a molecular weight of 451.30 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4,4,5,5-tetrakis(2-methylpropyl)-1,3,2-dioxaborolane.
| Compound Name | 2-(2-bromophenyl)-4,4,5,5-tetrakis(2-methylpropyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177401957 |
| Molecular Formula | C24H40BBrO2 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-(2-bromophenyl)-4,4,5,5-tetrakis(2-methylpropyl)-1,3,2-dioxaborolane |
| SMILES | CC(C)CC1(CC(C)C)OB(c2ccccc2Br)OC1(CC(C)C)CC(C)C |
| InChI | InChI=1S/C24H40BBrO2/c1-17(2)13-23(14-18(3)4)24(15-19(5)6,16-20(7)8)28-25(27-23)21-11-9-10-12-22(21)26/h9-12,17-20H,13-16H2,1-8H3 |
| InChIKey | WAOYMGPEKKUDII-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|