C26H42O8 — CID 177402789
(3E,5E,7R,8R,9E,11E,13S,18R)-7,17-dimethoxy-8,18-bis(methoxymethoxy)-11,13-dimethyl-1-oxacyclononadeca-3,5,9,11-tetraen-2-one (PubChem CID 177402789) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is (3E,5E,7R,8R,9E,11E,13S,18R)-7,17-dimethoxy-8,18-bis(methoxymethoxy)-11,13-dimethyl-1-oxacyclononadeca-3,5,9,11-tetraen-2-one.
| Compound Name | (3E,5E,7R,8R,9E,11E,13S,18R)-7,17-dimethoxy-8,18-bis(methoxymethoxy)-11,13-dimethyl-1-oxacyclononadeca-3,5,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 177402789 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (3E,5E,7R,8R,9E,11E,13S,18R)-7,17-dimethoxy-8,18-bis(methoxymethoxy)-11,13-dimethyl-1-oxacyclononadeca-3,5,9,11-tetraen-2-one |
| SMILES | COCO[C@@H]1COC(=O)/C=C/C=C/[C@@H](OC)[C@H](OCOC)/C=C/C(C)=C/[C@@H](C)CCCC1OC |
| InChI | InChI=1S/C26H42O8/c1-20-10-9-12-23(31-6)25(34-19-29-4)17-32-26(27)13-8-7-11-22(30-5)24(33-18-28-3)15-14-21(2)16-20/h7-8,11,13-16,20,22-25H,9-10,12,17-19H2,1-6H3/b11-7+,13-8+,15-14+,21-16+/t20-,22+,23?,24+,25+/m0/s1 |
| InChIKey | OLZGPJGMBRZJSH-LIFCKHAWSA-N |
| XLogP | 3.97 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|