About 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene
6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene (PubChem CID 177402979) has the molecular formula C29H52O4
and a molecular weight of 464.73 g/mol. Its IUPAC name is 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene.
Molecular Properties
| Compound Name | 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene |
| PubChem CID | 177402979 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene |
| SMILES | C=CCCCCOCC(COCCCCC=C)(COCCCCC=C)COCCCCC=C |
| InChI | InChI=1S/C29H52O4/c1-5-9-13-17-21-30-25-29(26-31-22-18-14-10-6-2,27-32-23-19-15-11-7-3)28-33-24-20-16-12-8-4/h5-8H,1-4,9-28H2 |
| InChIKey | GVARGLMQYQZCIO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene?
The IUPAC name of 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene (CID 177402979) is 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene.
What is the SMILES notation for 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene?
The canonical SMILES for 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene is C=CCCCCOCC(COCCCCC=C)(COCCCCC=C)COCCCCC=C.
What is the InChIKey of 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene?
The InChIKey is GVARGLMQYQZCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H52O4/c1-5-9-13-17-21-30-25-29(26-31-22-18-14-10-6-2,27-32-23-19-15-11-7-3)28-33-24-20-16-12-8-4/h5-8H,1-4,9-28H2.
What are the key properties of 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene?
6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene has a molecular weight of 464.73 g/mol, XLogP of 7.46, 28 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene is sourced from PubChem (CID 177402979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).