C29H52O4 — CID 177402979
6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene (PubChem CID 177402979) has the molecular formula C29H52O4 and a molecular weight of 464.73 g/mol. Its IUPAC name is 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene.
| Compound Name | 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene |
|---|---|
| PubChem CID | 177402979 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | 6-[3-hex-5-enoxy-2,2-bis(hex-5-enoxymethyl)propoxy]hex-1-ene |
| SMILES | C=CCCCCOCC(COCCCCC=C)(COCCCCC=C)COCCCCC=C |
| InChI | InChI=1S/C29H52O4/c1-5-9-13-17-21-30-25-29(26-31-22-18-14-10-6-2,27-32-23-19-15-11-7-3)28-33-24-20-16-12-8-4/h5-8H,1-4,9-28H2 |
| InChIKey | GVARGLMQYQZCIO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|