C30H26N6 — CID 177403667
(5Z,9E,14Z,19Z)-5,15-diethyl-20-ethynyl-10-(1-methylimidazol-2-yl)-1,22-dihydroporphyrin (PubChem CID 177403667) has the molecular formula C30H26N6 and a molecular weight of 470.58 g/mol. Its IUPAC name is (5Z,9E,14Z,19Z)-5,15-diethyl-20-ethynyl-10-(1-methylimidazol-2-yl)-1,22-dihydroporphyrin.
| Compound Name | (5Z,9E,14Z,19Z)-5,15-diethyl-20-ethynyl-10-(1-methylimidazol-2-yl)-1,22-dihydroporphyrin |
|---|---|
| PubChem CID | 177403667 |
| Molecular Formula | C30H26N6 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (5Z,9E,14Z,19Z)-5,15-diethyl-20-ethynyl-10-(1-methylimidazol-2-yl)-1,22-dihydroporphyrin |
| SMILES | C#C/C1=C2\C=CC(=N2)/C(CC)=C2/C=CC(=N2)/C(c2nccn2C)=c2/cc/c([nH]2)=C(\CC)C2=NC1C=C2 |
| InChI | InChI=1S/C30H26N6/c1-5-18-21-8-10-23(32-21)19(6-2)25-12-14-27(34-25)29(30-31-16-17-36(30)4)28-15-13-26(35-28)20(7-3)24-11-9-22(18)33-24/h1,8-17,21,34H,6-7H2,2-4H3/b22-18-,25-19-,26-20-,29-27+ |
| InChIKey | KITBWYJXBZFMMQ-JJPFSRFKSA-N |
| XLogP | 3.47 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|